Online Database of Chemicals from Around the World
|
CAS#: 56795-67-6 Product: 2,3,7,8-Tetrachlorodibenzo(b,e)(1,4)dioxin No suppilers available for the product. |
| Name | 2,3,7,8-Tetrachlorodibenzo(b,e)(1,4)dioxin |
|---|---|
| Synonyms | 2,3,7,8-Tetrachloro-Dibenzo[B,E][1,4]Dioxin; Aids-105033; Aids105033 |
| Molecular Structure |  |
| Molecular Formula | C12H4Cl4O2 |
| Molecular Weight | 321.97 |
| CAS Registry Number | 56795-67-6 |
| SMILES | C1=C(Cl)C(=CC2=C1OC3=C(O2)C=C(C(=C3)Cl)Cl)Cl |
| InChI | 1S/C12H4Cl4O2/c13-5-1-9-10(2-6(5)14)18-12-4-8(16)7(15)3-11(12)17-9/h1-4H |
| InChIKey | HGUFODBRKLSHSI-UHFFFAOYSA-N |
| Density | 1.6±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 417.9±45.0°C at 760 mmHg (Cal.) |
| Flash point | 164.2±28.8°C (Cal.) |
| solubility | 0.00000002% |
| Market Analysis Reports |
| List of Reports Available for 2,3,7,8-Tetrachlorodibenzo(b,e)(1,4)dioxin |