|
CAS#: 56799-32-7 Product: 1,4-Bis(Dimethylamino)Anthraquinone No suppilers available for the product. |
| Name | 1,4-Bis(Dimethylamino)Anthraquinone |
|---|---|
| Synonyms | 1,4-Bis(Dimethylamino)-9,10-Anthraquinone; 1,4-Bis(Dimethylamino)Anthraquinone |
| Molecular Structure | ![]() |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 |
| CAS Registry Number | 56799-32-7 |
| EINECS | 260-388-4 |
| SMILES | C3=CC(=C2C(=O)C1=CC=CC=C1C(C2=C3N(C)C)=O)N(C)C |
| InChI | 1S/C18H18N2O2/c1-19(2)13-9-10-14(20(3)4)16-15(13)17(21)11-7-5-6-8-12(11)18(16)22/h5-10H,1-4H3 |
| InChIKey | OZMLRWPLFYWTPG-UHFFFAOYSA-N |
| Density | 1.252g/cm3 (Cal.) |
|---|---|
| Boiling point | 488.104°C at 760 mmHg (Cal.) |
| Flash point | 223.069°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4-Bis(Dimethylamino)Anthraquinone |