|
CAS#: 56818-06-5 Product: 1,2,3,4-Tetrahydro-2-(1-Naphthalenylmethyl)Naphthalene No suppilers available for the product. |
| Name | 1,2,3,4-Tetrahydro-2-(1-Naphthalenylmethyl)Naphthalene |
|---|---|
| Synonyms | 1-(Tetralin-2-Ylmethyl)Naphthalene; 1-(2-Tetralinylmethyl)Naphthalene; 2-(1-Naphthylmethyl)-1,2,3,4-Tetrahydronaphthalene |
| Molecular Structure | ![]() |
| Molecular Formula | C21H20 |
| Molecular Weight | 272.39 |
| CAS Registry Number | 56818-06-5 |
| SMILES | C1=CC=C4C(=C1CC2CC3=C(CC2)C=CC=C3)C=CC=C4 |
| InChI | 1S/C21H20/c1-2-8-19-14-16(12-13-17(19)6-1)15-20-10-5-9-18-7-3-4-11-21(18)20/h1-11,16H,12-15H2 |
| InChIKey | PXYDLIUAIBQLBW-UHFFFAOYSA-N |
| Density | 1.095g/cm3 (Cal.) |
|---|---|
| Boiling point | 436.713°C at 760 mmHg (Cal.) |
| Flash point | 212.714°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,4-Tetrahydro-2-(1-Naphthalenylmethyl)Naphthalene |