|
CAS#: 568-40-1 Product: Masonine No suppilers available for the product. |
| Name | Masonine |
|---|---|
| Synonyms | Masonine; 1-Methyl-9,10-Methylene-Bis(Oxy)Lycorenan-7-One; Lycorenan-7-One, 1-Methyl-9,10-(Methylenebis(Oxy))- |
| Molecular Structure | ![]() |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 |
| CAS Registry Number | 568-40-1 |
| SMILES | C2=C1C4C(OC(=O)C1=CC3=C2OCO3)CC=C5C4N(CC5)C |
| InChI | 1S/C17H17NO4/c1-18-5-4-9-2-3-12-15(16(9)18)10-6-13-14(21-8-20-13)7-11(10)17(19)22-12/h2,6-7,12,15-16H,3-5,8H2,1H3 |
| InChIKey | WSTVHYSEOYCWBB-UHFFFAOYSA-N |
| Density | 1.42g/cm3 (Cal.) |
|---|---|
| Boiling point | 482.987°C at 760 mmHg (Cal.) |
| Flash point | 245.902°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Masonine |