|
CAS#: 5690-16-4 Product: Azanium 1,4-Dioxonaphthalene-2-Sulfonate No suppilers available for the product. |
| Name | Azanium 1,4-Dioxonaphthalene-2-Sulfonate |
|---|---|
| Synonyms | Ammonium 1,4-Dioxonaphthalene-2-Sulfonate; Ammonium 1,4-Dioxo-2-Naphthalenesulfonate; Ammonium 1,4-Diketonaphthalene-2-Sulfonate |
| Molecular Structure | ![]() |
| Molecular Formula | C10H9NO5S |
| Molecular Weight | 255.24 |
| CAS Registry Number | 5690-16-4 (56633-19-3) |
| SMILES | C1=C2C(=CC=C1)C(=O)C=C([S](=O)(=O)[O-])C2=O.[NH4+] |
| InChI | 1S/C10H6O5S.H3N/c11-8-5-9(16(13,14)15)10(12)7-4-2-1-3-6(7)8;/h1-5H,(H,13,14,15);1H3 |
| InChIKey | NXKJPCDZJAZKRM-UHFFFAOYSA-N |
| Boiling point | 521.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 269.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Azanium 1,4-Dioxonaphthalene-2-Sulfonate |