|
CAS#: 56935-95-6 Product: Potassium N-phenyl-2-ethylhexanamide No suppilers available for the product. |
| Name | Potassium N-phenyl-2-ethylhexanamide |
|---|---|
| Synonyms | Potassium 2-Ethyl-N-Phenyl-Hexanamide; Potassium 2-Ethyl-N-Phenylhexanamidate; Potassium N-Phenyl-2-Ethylhexanamide |
| Molecular Structure | ![]() |
| Molecular Formula | C14H21KNO |
| Molecular Weight | 258.42 |
| CAS Registry Number | 56935-95-6 |
| EINECS | 260-455-8 |
| SMILES | C1=C(NC(=O)C(CCCC)CC)C=CC=C1.[K+] |
| InChI | 1S/C14H21NO.K/c1-3-5-9-12(4-2)14(16)15-13-10-7-6-8-11-13;/h6-8,10-12H,3-5,9H2,1-2H3,(H,15,16);/q;+1 |
| InChIKey | STKSLENNLNGAKS-UHFFFAOYSA-N |
| Boiling point | 371.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 224.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Potassium N-phenyl-2-ethylhexanamide |