|
CAS#: 5695-98-7 Product: Cotinine fumarate No suppilers available for the product. |
| Name | Cotinine fumarate |
|---|---|
| Synonyms | But-2-Enedioic Acid; (5R)-1-Methyl-5-(3-Pyridyl)Pyrrolidin-2-One; (5R)-1-Methyl-5-(3-Pyridyl)Pyrrolidin-2-One; But-2-Enedioic Acid; (5R)-1-Methyl-5-(3-Pyridyl)-2-Pyrrolidinone; (5R)-1-Methyl-5-(3-Pyridyl)-2-Pyrrolidinone |
| Molecular Structure | ![]() |
| Molecular Formula | C24H28N4O6 |
| Molecular Weight | 468.51 |
| CAS Registry Number | 5695-98-7 |
| SMILES | [C@H]1(N(C(=O)CC1)C)C2=CC=CN=C2.[C@H]3(N(C(=O)CC3)C)C4=CC=CN=C4.O=C(O)\C=C\C(=O)O |
| InChI | 1S/2C10H12N2O.C4H4O4/c2*1-12-9(4-5-10(12)13)8-3-2-6-11-7-8;5-3(6)1-2-4(7)8/h2*2-3,6-7,9H,4-5H2,1H3;1-2H,(H,5,6)(H,7,8)/b;;2-1+/t2*9-;/m11./s1 |
| InChIKey | NXHGVNVRWLOZDF-ATCUPGDDSA-N |
| Boiling point | 316°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 166.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Cotinine fumarate |