|
CAS#: 56979-88-5 Product: 2-Chloro-2-Phenylethyl Allophanate No suppilers available for the product. |
| Name | 2-Chloro-2-Phenylethyl Allophanate |
|---|---|
| Synonyms | N-Carbamoyl-N-(2-Chlorophenyl)Carbamic Acid Ethyl Ester; Ethyl N-Aminocarbonyl-N-(2-Chlorophenyl)Carbamate; 2-(2-Chlorophenyl)Allophanic Acid Ethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C10H11ClN2O3 |
| Molecular Weight | 242.66 |
| CAS Registry Number | 56979-88-5 |
| SMILES | C1=CC=CC(=C1N(C(OCC)=O)C(N)=O)Cl |
| InChI | 1S/C10H11ClN2O3/c1-2-16-10(15)13(9(12)14)8-6-4-3-5-7(8)11/h3-6H,2H2,1H3,(H2,12,14) |
| InChIKey | DIPOJLBMCDRHCA-UHFFFAOYSA-N |
| Density | 1.374g/cm3 (Cal.) |
|---|---|
| Boiling point | 350.884°C at 760 mmHg (Cal.) |
| Flash point | 166.009°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-2-Phenylethyl Allophanate |