|
CAS#: 57020-37-8 Product: 1-(6,6-Dimethyl-2-Methylene-3-Cyclohexen-1-Yl)-1-Buten-2-One No suppilers available for the product. |
| Name | 1-(6,6-Dimethyl-2-Methylene-3-Cyclohexen-1-Yl)-1-Buten-2-One |
|---|---|
| Synonyms | (Z)-1-(6,6-Dimethyl-2-Methylene-1-Cyclohex-3-Enyl)But-2-En-1-One; 1-(6,6-Dimethyl-2-Methylene-3-Cyclohexen-1-Yl)-1-Buten-2-One |
| Molecular Structure | ![]() |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.28 |
| CAS Registry Number | 57020-37-8 |
| EINECS | 260-520-0 |
| SMILES | CC1(C(C(C=CC1)=C)C(\C=C/C)=O)C |
| InChI | 1S/C13H18O/c1-5-7-11(14)12-10(2)8-6-9-13(12,3)4/h5-8,12H,2,9H2,1,3-4H3/b7-5- |
| InChIKey | NTFPXECSILEYKG-ALCCZGGFSA-N |
| Density | 0.931g/cm3 (Cal.) |
|---|---|
| Boiling point | 272.086°C at 760 mmHg (Cal.) |
| Flash point | 108.965°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(6,6-Dimethyl-2-Methylene-3-Cyclohexen-1-Yl)-1-Buten-2-One |