|
CAS#: 57054-96-3 Product: 4-(Benzylamino)Butyric Acid Hydrochloride No suppilers available for the product. |
| Name | 4-(Benzylamino)Butyric Acid Hydrochloride |
|---|---|
| Synonyms | 4-(Benzylamino)Butyric Acid Hydrochloride; 4-(Phenylmethylamino)Butanoic Acid Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C11H16ClNO2 |
| Molecular Weight | 229.71 |
| CAS Registry Number | 57054-96-3 |
| EINECS | 260-533-1 |
| SMILES | [H+].C1=C(CNCCCC(O)=O)C=CC=C1.[Cl-] |
| InChI | 1S/C11H15NO2.ClH/c13-11(14)7-4-8-12-9-10-5-2-1-3-6-10;/h1-3,5-6,12H,4,7-9H2,(H,13,14);1H |
| InChIKey | BDZYWVNAYHSTKE-UHFFFAOYSA-N |
| Boiling point | 355.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 168.9°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-(Benzylamino)Butyric Acid Hydrochloride |