|
CAS#: 57103-59-0 Product: (3S)-2,3,4,4aalpha,5,6,11,11aalpha-Octahydro-2,2,5-Trimethyl-3,5beta-Ethano-1H-Pyrido[3,2-b]Carbazole No suppilers available for the product. |
| Name | (3S)-2,3,4,4aalpha,5,6,11,11aalpha-Octahydro-2,2,5-Trimethyl-3,5beta-Ethano-1H-Pyrido[3,2-b]Carbazole |
|---|---|
| Synonyms | Aristoteline B668273k010; Aristoteline; Nsc286324 |
| Molecular Structure | ![]() |
| Molecular Formula | C20H26N2 |
| Molecular Weight | 294.44 |
| CAS Registry Number | 57103-59-0 |
| SMILES | C1=CC=CC5=C1C4=C(C2(C3CC(CC2)C(NC3C4)(C)C)C)[NH]5 |
| InChI | 1S/C20H26N2/c1-19(2)12-8-9-20(3)15(10-12)17(22-19)11-14-13-6-4-5-7-16(13)21-18(14)20/h4-7,12,15,17,21-22H,8-11H2,1-3H3 |
| InChIKey | QYBCOSRUKXCALD-UHFFFAOYSA-N |
| Density | 1.105g/cm3 (Cal.) |
|---|---|
| Boiling point | 444.046°C at 760 mmHg (Cal.) |
| Flash point | 222.351°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3S)-2,3,4,4aalpha,5,6,11,11aalpha-Octahydro-2,2,5-Trimethyl-3,5beta-Ethano-1H-Pyrido[3,2-b]Carbazole |