|
CAS#: 573-12-6 Product: 1,2-Phenanthrenequinone No suppilers available for the product. |
| Name | 1,2-Phenanthrenequinone |
|---|---|
| Synonyms | Phenanthrene-1,2-Quinone; 1,2-Dioxophenanthrene; 1,2-Phenanthrenedione |
| Molecular Structure | ![]() |
| Molecular Formula | C14H8O2 |
| Molecular Weight | 208.22 |
| CAS Registry Number | 573-12-6 |
| SMILES | C1=CC=CC3=C1C2=C(C(C(C=C2)=O)=O)C=C3 |
| InChI | 1S/C14H8O2/c15-13-8-7-11-10-4-2-1-3-9(10)5-6-12(11)14(13)16/h1-8H |
| InChIKey | SCOAVUHOIJMIBW-UHFFFAOYSA-N |
| Density | 1.329g/cm3 (Cal.) |
|---|---|
| Boiling point | 404.324°C at 760 mmHg (Cal.) |
| Flash point | 170.902°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Phenanthrenequinone |