|
CAS#: 5736-15-2 Product: Sodium Hydrogen 2,2'-Methylenebis[3,4,6-Trichlorophenolate] No suppilers available for the product. |
| Name | Sodium Hydrogen 2,2'-Methylenebis[3,4,6-Trichlorophenolate] |
|---|---|
| Synonyms | Sodium 3,4,6-Trichloro-2-[(2,3,5-Trichloro-6-Hydroxy-Phenyl)Methyl]Phenolate; Sodium 3,4,6-Trichloro-2-(2,3,5-Trichloro-6-Hydroxy-Benzyl)Phenolate; 2,2'-Methylenebis(3,4,6-Trichlorophenol) Sodium Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C13H5Cl6NaO2 |
| Molecular Weight | 428.89 |
| CAS Registry Number | 5736-15-2 |
| EINECS | 227-245-8 |
| SMILES | C1=C(Cl)C(=C(C(=C1Cl)Cl)CC2=C(Cl)C(=CC(=C2O)Cl)Cl)[O-].[Na+] |
| InChI | 1S/C13H6Cl6O2.Na/c14-6-2-8(16)12(20)4(10(6)18)1-5-11(19)7(15)3-9(17)13(5)21;/h2-3,20-21H,1H2;/q;+1/p-1 |
| InChIKey | JNAQOQQXXBMQKT-UHFFFAOYSA-M |
| Boiling point | 470.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 238.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sodium Hydrogen 2,2'-Methylenebis[3,4,6-Trichlorophenolate] |