Online Database of Chemicals from Around the World
|
CAS#: 5736-49-2 Product: 1,1'-(Bromomethylene)Bis[2,3,4,5,6-Pentafluorobenzene] No suppilers available for the product. |
| Name | 1,1'-(Bromomethylene)Bis[2,3,4,5,6-Pentafluorobenzene] |
|---|---|
| Synonyms | 1-[Bromo-(2,3,4,5,6-Pentafluorophenyl)Methyl]-2,3,4,5,6-Pentafluoro-Benzene; 1,1'-(Bromomethylene)Bis(2,3,4,5,6-Pentafluorobenzene); Brn 2067250 |
| Molecular Structure | ![CAS#: 5736-49-2, 1,1'-(Bromomethylene)Bis[2,3,4,5,6-Pentafluorobenzene]](/moreStructures/5736-49-2.gif) |
| Molecular Formula | C13HBrF10 |
| Molecular Weight | 427.04 |
| CAS Registry Number | 5736-49-2 |
| EINECS | 227-246-3 |
| SMILES | C1(=C(C(=C(F)C(=C1F)F)F)F)C(C2=C(C(=C(F)C(=C2F)F)F)F)Br |
| InChI | 1S/C13HBrF10/c14-3(1-4(15)8(19)12(23)9(20)5(1)16)2-6(17)10(21)13(24)11(22)7(2)18/h3H |
| InChIKey | YNRCTGFUNFLXMR-UHFFFAOYSA-N |
| Density | 1.899g/cm3 (Cal.) |
|---|---|
| Boiling point | 256.974°C at 760 mmHg (Cal.) |
| Flash point | 109.214°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,1'-(Bromomethylene)Bis[2,3,4,5,6-Pentafluorobenzene] |