|
CAS#: 5746-45-2 Product: 16-Hydroxyandrost-4-En-3,17-Dione No suppilers available for the product. |
| Name | 16-Hydroxyandrost-4-En-3,17-Dione |
|---|---|
| Synonyms | (8R,9S,10R,13S,14S)-16-Hydroxy-10,13-Dimethyl-2,6,7,8,9,11,12,14,15,16-Decahydro-1H-Cyclopenta[A]Phenanthrene-3,17-Quinone; Androst-4-Ene-3,17-Dione, 16-Hydroxy-, (16Alpha)-; 16-Hydroxyandrost-4-En-3,17-Dione |
| Molecular Structure | ![]() |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 |
| CAS Registry Number | 5746-45-2 |
| SMILES | [C@H]23[C@@H]([C@@]1(C(=CC(=O)CC1)CC2)C)CC[C@]4([C@H]3CC(O)C4=O)C |
| InChI | 1S/C19H26O3/c1-18-7-5-12(20)9-11(18)3-4-13-14(18)6-8-19(2)15(13)10-16(21)17(19)22/h9,13-16,21H,3-8,10H2,1-2H3/t13-,14+,15+,16?,18+,19+/m1/s1 |
| InChIKey | SSBCZTXGVMMZOT-DTCRIMCDSA-N |
| Density | 1.191g/cm3 (Cal.) |
|---|---|
| Boiling point | 475.33°C at 760 mmHg (Cal.) |
| Flash point | 255.382°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 16-Hydroxyandrost-4-En-3,17-Dione |