|
CAS#: 5746-95-2 Product: 1,1'-(4-Chloro-1-Butenylidene)Bisbenzene No suppilers available for the product. |
| Name | 1,1'-(4-Chloro-1-Butenylidene)Bisbenzene |
|---|---|
| Synonyms | (4-Chloro-1-Phenyl-But-1-Enyl)Benzene; 1,1'-(4-Chloro-1-Butenylidene)Bisbenzene |
| Molecular Structure | ![]() |
| Molecular Formula | C16H15Cl |
| Molecular Weight | 242.75 |
| CAS Registry Number | 5746-95-2 |
| EINECS | 227-272-5 |
| SMILES | C2=C(C(C1=CC=CC=C1)=CCCCl)C=CC=C2 |
| InChI | 1S/C16H15Cl/c17-13-7-12-16(14-8-3-1-4-9-14)15-10-5-2-6-11-15/h1-6,8-12H,7,13H2 |
| InChIKey | XGOZGDXXUIRGTQ-UHFFFAOYSA-N |
| Density | 1.08g/cm3 (Cal.) |
|---|---|
| Boiling point | 377.086°C at 760 mmHg (Cal.) |
| Flash point | 172.202°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1'-(4-Chloro-1-Butenylidene)Bisbenzene |