|
CAS#: 57485-60-6 Product: (13R,22R)-13,14:18,20-Diepoxy-14,18,22-Trihydroxy-1-Oxo-13,14-Secoergosta-2,5,24-Trien-26-Oic Acid 26,22-Lactone No suppilers available for the product. |
| Name | (13R,22R)-13,14:18,20-Diepoxy-14,18,22-Trihydroxy-1-Oxo-13,14-Secoergosta-2,5,24-Trien-26-Oic Acid 26,22-Lactone |
|---|---|
| Synonyms | Withaphysalin C |
| Molecular Structure | ![]() |
| Molecular Formula | C28H36O7 |
| Molecular Weight | 484.59 |
| CAS Registry Number | 57485-60-6 |
| SMILES | CC4(OC(O)C35OC(O)(C1C(C2(C(=CC1)C=CCC2=O)C)CC3)CCC45)C6OC(=O)C(=C(C6)C)C |
| InChI | 1S/C28H36O7/c1-15-14-22(33-23(30)16(15)2)26(4)20-11-13-28(32)19-9-8-17-6-5-7-21(29)25(17,3)18(19)10-12-27(20,35-28)24(31)34-26/h5-6,8,18-20,22,24,31-32H,7,9-14H2,1-4H3 |
| InChIKey | KCDDRMMSSUETPV-UHFFFAOYSA-N |
| Density | 1.328g/cm3 (Cal.) |
|---|---|
| Boiling point | 712.162°C at 760 mmHg (Cal.) |
| Flash point | 238.13°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (13R,22R)-13,14:18,20-Diepoxy-14,18,22-Trihydroxy-1-Oxo-13,14-Secoergosta-2,5,24-Trien-26-Oic Acid 26,22-Lactone |