|
CAS#: 57543-81-4 Product: 6-Methoxy-2-Methyl-3-Nitro-2H-1-Benzopyran No suppilers available for the product. |
| Name | 6-Methoxy-2-Methyl-3-Nitro-2H-1-Benzopyran |
|---|---|
| Synonyms | 2H-1-Benzopyran, 6-Methoxy-2-Methyl-3-Nitro-; 6-Methoxy-2-Methyl-3-Nitro-2H-1-Benzopyran; Brn 1429565 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H11NO4 |
| Molecular Weight | 221.21 |
| CAS Registry Number | 57543-81-4 |
| SMILES | C1=C(OC)C=CC2=C1C=C([N+]([O-])=O)C(O2)C |
| InChI | 1S/C11H11NO4/c1-7-10(12(13)14)6-8-5-9(15-2)3-4-11(8)16-7/h3-7H,1-2H3 |
| InChIKey | RUPZVYKLQQEGAZ-UHFFFAOYSA-N |
| Density | 1.292g/cm3 (Cal.) |
|---|---|
| Boiling point | 349.355°C at 760 mmHg (Cal.) |
| Flash point | 160.236°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Methoxy-2-Methyl-3-Nitro-2H-1-Benzopyran |