|
CAS#: 57548-07-9 Product: 2,2-Dithiobis(4,6-Dichlorophenol) No suppilers available for the product. |
| Name | 2,2-Dithiobis(4,6-Dichlorophenol) |
|---|---|
| Synonyms | 2,4-Dichloro-6-(3,5-Dichloro-2-Hydroxy-Phenyl)Disulfanyl-Phenol; 2,2-Dithiobis(4,6-Dichlorophenol); Dtbdcp |
| Molecular Structure | ![]() |
| Molecular Formula | C12H6Cl4O2S2 |
| Molecular Weight | 388.11 |
| CAS Registry Number | 57548-07-9 |
| SMILES | C2=C(SSC1=CC(=CC(=C1O)Cl)Cl)C(=C(Cl)C=C2Cl)O |
| InChI | 1S/C12H6Cl4O2S2/c13-5-1-7(15)11(17)9(3-5)19-20-10-4-6(14)2-8(16)12(10)18/h1-4,17-18H |
| InChIKey | YVALZDKTCRMZLQ-UHFFFAOYSA-N |
| Density | 1.792g/cm3 (Cal.) |
|---|---|
| Boiling point | 446.992°C at 760 mmHg (Cal.) |
| Flash point | 224.133°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2-Dithiobis(4,6-Dichlorophenol) |