|
CAS#: 57661-45-7 Product: cis-(4-Chlorophenyl)(octahydro-2H-quinolizin-2-yl)Methanone No suppilers available for the product. |
| Name | cis-(4-Chlorophenyl)(octahydro-2H-quinolizin-2-yl)Methanone |
|---|---|
| Synonyms | [(2R,9As)-Quinolizidin-2-Yl]-(4-Chlorophenyl)Methanone; Hsr 740; Hsr-740 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H20ClNO |
| Molecular Weight | 277.79 |
| CAS Registry Number | 57661-45-7 |
| SMILES | [C@H]2(C(=O)C1=CC=C(C=C1)Cl)C[C@H]3N(CC2)CCCC3 |
| InChI | 1S/C16H20ClNO/c17-14-6-4-12(5-7-14)16(19)13-8-10-18-9-2-1-3-15(18)11-13/h4-7,13,15H,1-3,8-11H2/t13-,15+/m1/s1 |
| InChIKey | FXZJUVNEMFIWMF-HIFRSBDPSA-N |
| Density | 1.196g/cm3 (Cal.) |
|---|---|
| Boiling point | 404.532°C at 760 mmHg (Cal.) |
| Flash point | 198.454°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for cis-(4-Chlorophenyl)(octahydro-2H-quinolizin-2-yl)Methanone |