Online Database of Chemicals from Around the World
|
CAS#: 57668-61-8 Product: 1,1'-(4-Bromobutylidene)Bis[4-Fluorobenzene] No suppilers available for the product. |
| Name | 1,1'-(4-Bromobutylidene)Bis[4-Fluorobenzene] |
|---|---|
| Synonyms | 1-[4-Bromo-1-(4-Fluorophenyl)Butyl]-4-Fluoro-Benzene; 1,1'-(4-Bromobutylidene)Bis(4-Fluorobenzene) |
| Molecular Structure | ![CAS#: 57668-61-8, 1,1'-(4-Bromobutylidene)Bis[4-Fluorobenzene]](/moreStructures/57668-61-8.gif) |
| Molecular Formula | C16H15BrF2 |
| Molecular Weight | 325.20 |
| CAS Registry Number | 57668-61-8 |
| EINECS | 260-890-3 |
| SMILES | C2=C(C(C1=CC=C(C=C1)F)CCCBr)C=CC(=C2)F |
| InChI | 1S/C16H15BrF2/c17-11-1-2-16(12-3-7-14(18)8-4-12)13-5-9-15(19)10-6-13/h3-10,16H,1-2,11H2 |
| InChIKey | AJHQYQYRIDMWON-UHFFFAOYSA-N |
| Density | 1.351g/cm3 (Cal.) |
|---|---|
| Boiling point | 379.394°C at 760 mmHg (Cal.) |
| Flash point | 183.251°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1'-(4-Bromobutylidene)Bis[4-Fluorobenzene] |