|
CAS#: 57693-55-7 Product: 1,3-Butadiene, 2-hydroxyethyl 2-propenoate, 2-propenenitrile polymer No suppilers available for the product. |
| Name | 1,3-Butadiene, 2-hydroxyethyl 2-propenoate, 2-propenenitrile polymer |
|---|---|
| Synonyms | Buta-1,3-Diene; Prop-2-Enenitrile; Prop-2-Enoic Acid 2-Hydroxyethyl Ester; Acrylic Acid 2-Hydroxyethyl Ester; Acrylonitrile; Buta-1,3-Diene |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 |
| CAS Registry Number | 57693-55-7 |
| SMILES | C(OC(=O)C=C)CO.C(C#N)=C.C(C=C)=C |
| InChI | 1S/C5H8O3.C4H6.C3H3N/c1-2-5(7)8-4-3-6;1-3-4-2;1-2-3-4/h2,6H,1,3-4H2;3-4H,1-2H2;2H,1H2 |
| InChIKey | DNLKZUOZZHSZFQ-UHFFFAOYSA-N |
| Market Analysis Reports |
| List of Reports Available for 1,3-Butadiene, 2-hydroxyethyl 2-propenoate, 2-propenenitrile polymer |