| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 1-(2,4-Dihydroxy-3,5-Dimethylphenyl)-Ethanone |
|---|---|
| Synonyms | 1-(2,4-Dihydroxy-3,5-Dimethyl-Phenyl)Ethanone; Ethanone, 1-(2,4-Dihydroxy-3,5-Dimethylphenyl)-; Acetylphenone, 2',4'-Dihydroxy-3',5'-Dimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 |
| CAS Registry Number | 577-45-7 |
| SMILES | C1=C(C(=C(C)C(=C1C)O)O)C(=O)C |
| InChI | 1S/C10H12O3/c1-5-4-8(7(3)11)10(13)6(2)9(5)12/h4,12-13H,1-3H3 |
| InChIKey | AMZNYVFIWCPUAY-UHFFFAOYSA-N |
| Density | 1.198g/cm3 (Cal.) |
|---|---|
| Boiling point | 350.204°C at 760 mmHg (Cal.) |
| Flash point | 179.792°C (Cal.) |
| (1) | S.-Y. Li, J.-F. Wang, Z.-H. Zheng, Q.-Y. Xu, Y.-J. Huang, Y.-F. Zhao and W.-J. Su. 1-(2,4-Dihydroxy-3,5-dimethylphenyl)-ethanone (Clavatol), Acta Cryst. (2003). E59, o1469-o1470 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-(2,4-Dihydroxy-3,5-Dimethylphenyl)-Ethanone |