|
CAS#: 57762-41-1 Product: 2-(Acetyloxy)-Benzoic acid mixt. with propyl 4-hydroxybenzoate No suppilers available for the product. |
| Name | 2-(Acetyloxy)-Benzoic acid mixt. with propyl 4-hydroxybenzoate |
|---|---|
| Synonyms | 2-Acetoxybenzoic Acid; Propyl 4-Hydroxybenzoate; 2-Acetoxybenzoic Acid; 4-Hydroxybenzoic Acid Propyl Ester; Apernyl |
| Molecular Structure | ![]() |
| Molecular Formula | C19H20O7 |
| Molecular Weight | 360.36 |
| CAS Registry Number | 57762-41-1 |
| SMILES | C1=C(C(=CC=C1)OC(=O)C)C(=O)O.C2=C(C(OCCC)=O)C=CC(=C2)O |
| InChI | 1S/C10H12O3.C9H8O4/c1-2-7-13-10(12)8-3-5-9(11)6-4-8;1-6(10)13-8-5-3-2-4-7(8)9(11)12/h3-6,11H,2,7H2,1H3;2-5H,1H3,(H,11,12) |
| InChIKey | GQGDGKQGOTVVRX-UHFFFAOYSA-N |
| Boiling point | 294.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 124.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Acetyloxy)-Benzoic acid mixt. with propyl 4-hydroxybenzoate |