|
CAS#: 5773-98-8 Product: 4-Aminonaphthalene-2-Carboxylic Acid No suppilers available for the product. |
| Name | 4-Aminonaphthalene-2-Carboxylic Acid |
|---|---|
| Synonyms | 4-Amino-2-Naphthalenecarboxylic Acid; 4-Amino-2-Naphthoic Acid; Aids167070 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H9NO2 |
| Molecular Weight | 187.20 |
| CAS Registry Number | 5773-98-8 |
| SMILES | C2=C(C=C1C=CC=CC1=C2N)C(O)=O |
| InChI | 1S/C11H9NO2/c12-10-6-8(11(13)14)5-7-3-1-2-4-9(7)10/h1-6H,12H2,(H,13,14) |
| InChIKey | HLYLEARJBJRRTJ-UHFFFAOYSA-N |
| Density | 1.353g/cm3 (Cal.) |
|---|---|
| Boiling point | 411.122°C at 760 mmHg (Cal.) |
| Flash point | 202.44°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Aminonaphthalene-2-Carboxylic Acid |