Online Database of Chemicals from Around the World
|
CAS#: 57734-47-1 Product: 5-(Aminosulphonyl)-2,3-Dimethoxybenzoyl Chloride No suppilers available for the product. |
| Name | 5-(Aminosulphonyl)-2,3-Dimethoxybenzoyl Chloride |
|---|---|
| Synonyms | 2,3-Dimethoxy-5-Sulfamoyl-Benzoyl Chloride; 5-(Aminosulphonyl)-2,3-Dimethoxybenzoyl Chloride |
| Molecular Structure |  |
| Molecular Formula | C9H10ClNO5S |
| Molecular Weight | 279.69 |
| CAS Registry Number | 57734-47-1 |
| EINECS | 260-921-0 |
| SMILES | C1=C([S](=O)(=O)N)C=C(C(=C1C(=O)Cl)OC)OC |
| InChI | 1S/C9H10ClNO5S/c1-15-7-4-5(17(11,13)14)3-6(9(10)12)8(7)16-2/h3-4H,1-2H3,(H2,11,13,14) |
| InChIKey | TZOCBFJIISELCS-UHFFFAOYSA-N |
| Density | 1.451g/cm3 (Cal.) |
|---|---|
| Boiling point | 484.292°C at 760 mmHg (Cal.) |
| Flash point | 246.691°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(Aminosulphonyl)-2,3-Dimethoxybenzoyl Chloride |