Online Database of Chemicals from Around the World
|
CAS#: 57765-65-8 Product: 5-Isopropyl-7-Methyl-2H-Naphtho[1,8-bc]Furan-3,4-Diol No suppilers available for the product. |
| Name | 5-Isopropyl-7-Methyl-2H-Naphtho[1,8-bc]Furan-3,4-Diol |
|---|---|
| Synonyms | Deoxyhemigossypol; 2H-Naphtho(1,8-Bc)Furan-3,4-Diol, 7-Methyl-5-(1-Methylethyl)- |
| Molecular Structure | ![CAS#: 57765-65-8, 5-Isopropyl-7-Methyl-2H-Naphtho[1,8-bc]Furan-3,4-Diol](/moreStructures/57765-65-8.gif) |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 |
| CAS Registry Number | 57765-65-8 |
| SMILES | C1=C(C=C3C2=C(C(=C(C(=C12)C(C)C)O)O)CO3)C |
| InChI | 1S/C15H16O3/c1-7(2)12-9-4-8(3)5-11-13(9)10(6-18-11)14(16)15(12)17/h4-5,7,16-17H,6H2,1-3H3 |
| InChIKey | UACUHHDLYFQIDS-UHFFFAOYSA-N |
| Density | 1.291g/cm3 (Cal.) |
|---|---|
| Boiling point | 447.942°C at 760 mmHg (Cal.) |
| Flash point | 224.708°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Isopropyl-7-Methyl-2H-Naphtho[1,8-bc]Furan-3,4-Diol |