|
CAS#: 5779-79-3 Product: 4,5-Dihydro-Benz(k)Acephenanthrylene No suppilers available for the product. |
| Name | 4,5-Dihydro-Benz(k)Acephenanthrylene |
|---|---|
| Synonyms | 4,5-Dihydrobenz(K)Acephenanthrylene; Acenaphthanthracene; Brn 3274312 |
| Molecular Structure | ![]() |
| Molecular Formula | C20H14 |
| Molecular Weight | 254.33 |
| CAS Registry Number | 5779-79-3 |
| SMILES | C2=C1C5=C4C(=CC1=CC3=C2C=CC=C3)CCC4=CC=C5 |
| InChI | 1S/C20H14/c1-2-5-15-12-19-17(10-14(15)4-1)11-16-9-8-13-6-3-7-18(19)20(13)16/h1-7,10-12H,8-9H2 |
| InChIKey | PMNATJJZOUNELG-UHFFFAOYSA-N |
| Density | 1.252g/cm3 (Cal.) |
|---|---|
| Boiling point | 494.971°C at 760 mmHg (Cal.) |
| Flash point | 245.294°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,5-Dihydro-Benz(k)Acephenanthrylene |