|
CAS#: 5781-55-5 Product: 2,5,8-Trioxanonane-3,4,6,7-Tetrone No suppilers available for the product. |
| Name | 2,5,8-Trioxanonane-3,4,6,7-Tetrone |
|---|---|
| Synonyms | (2-Methoxy-2-Oxo-Acetyl) Methyl Oxalate; Oxalic Acid (2-Methoxy-1,2-Dioxoethyl) Ester Methyl Ester; Oxalic Acid (2-Keto-2-Methoxy-Acetyl) Ester Methyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C6H6O7 |
| Molecular Weight | 190.11 |
| CAS Registry Number | 5781-55-5 |
| EINECS | 227-309-5 |
| SMILES | COC(=O)C(OC(=O)C(OC)=O)=O |
| InChI | 1S/C6H6O7/c1-11-3(7)5(9)13-6(10)4(8)12-2/h1-2H3 |
| InChIKey | JKFKZGGSAYSSBN-UHFFFAOYSA-N |
| Density | 1.407g/cm3 (Cal.) |
|---|---|
| Boiling point | 242.339°C at 760 mmHg (Cal.) |
| Flash point | 101.617°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,5,8-Trioxanonane-3,4,6,7-Tetrone |