Online Database of Chemicals from Around the World
|
CAS#: 57950-03-5 Product: 2-(Isopropylamino)-1,4-Naphthoquinone No suppilers available for the product. |
| Name | 2-(Isopropylamino)-1,4-Naphthoquinone |
|---|---|
| Synonyms | 2-(Isopropylamino)Naphthalene-1,4-Dione; 2-(Isopropylamino)-1,4-Naphthoquinone; 1,4-Naphthoquinone, 2-(Isopropylamino)- |
| Molecular Structure |  |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 |
| CAS Registry Number | 57950-03-5 |
| SMILES | C1=CC=CC2=C1C(C(=CC2=O)NC(C)C)=O |
| InChI | 1S/C13H13NO2/c1-8(2)14-11-7-12(15)9-5-3-4-6-10(9)13(11)16/h3-8,14H,1-2H3 |
| InChIKey | GEDMNZDVSCEEBO-UHFFFAOYSA-N |
| Density | 1.186g/cm3 (Cal.) |
|---|---|
| Boiling point | 356.115°C at 760 mmHg (Cal.) |
| Flash point | 144.189°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Isopropylamino)-1,4-Naphthoquinone |