|
CAS#: 58096-22-3 Product: [1R-(1alpha,2beta,3alpha,5alpha)]-Pinane-3-Methylammonium Chloride No suppilers available for the product. |
| Name | [1R-(1alpha,2beta,3alpha,5alpha)]-Pinane-3-Methylammonium Chloride |
|---|---|
| Synonyms | Methyl-[(1R,2R,5R)-2,6,6-Trimethylnorpinan-3-Yl]Ammonium Chloride; Methyl-[(1R,2R,5R)-2,6,6-Trimethyl-3-Norpinanyl]Ammonium Chloride; (1R-(1Alpha,2Beta,3Alpha,5Alpha))-Pinane-3-Methylammonium Chloride |
| Molecular Structure | ![]() |
| Molecular Formula | C11H22ClN |
| Molecular Weight | 203.75 |
| CAS Registry Number | 58096-22-3 |
| EINECS | 261-114-6 |
| SMILES | [C@@H]12C([C@H](C1)CC([NH2+]C)[C@@H]2C)(C)C.[Cl-] |
| InChI | 1S/C11H21N.ClH/c1-7-9-5-8(11(9,2)3)6-10(7)12-4;/h7-10,12H,5-6H2,1-4H3;1H/t7-,8-,9-,10?;/m1./s1 |
| InChIKey | SLBHRUVXKGEGPB-XUSZDSNDSA-N |
| Boiling point | 199.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 65.2°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for [1R-(1alpha,2beta,3alpha,5alpha)]-Pinane-3-Methylammonium Chloride |