|
CAS#: 58102-02-6 Product: 2-Methyl-4-(2,6,6-Trimethyl-2-Cyclohexen-1-Yl)-3-Butenal No suppilers available for the product. |
| Name | 2-Methyl-4-(2,6,6-Trimethyl-2-Cyclohexen-1-Yl)-3-Butenal |
|---|---|
| Synonyms | 3-Butenal, 2-Methyl-4-(2,6,6-Trimethyl-2-Cyclohexen-1-Yl)-; 2-Methyl-4-(2,6,6-Trimethyl-2-Cyclohexen-1-Yl)-3-Butenal |
| Molecular Structure | ![]() |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 |
| CAS Registry Number | 58102-02-6 |
| EINECS | 261-121-4 |
| SMILES | CC1(C(C(=CCC1)C)\C=C/C(C=O)C)C |
| InChI | 1S/C14H22O/c1-11(10-15)7-8-13-12(2)6-5-9-14(13,3)4/h6-8,10-11,13H,5,9H2,1-4H3/b8-7- |
| InChIKey | AISADLWIINCFJS-FPLPWBNLSA-N |
| Density | 0.926g/cm3 (Cal.) |
|---|---|
| Boiling point | 275.358°C at 760 mmHg (Cal.) |
| Flash point | 122.388°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-4-(2,6,6-Trimethyl-2-Cyclohexen-1-Yl)-3-Butenal |