|
CAS#: 58134-17-1 Product: 5,5-Dimethyl-2-Phenyl-1-Pyrroline-N-Oxide No suppilers available for the product. |
| Name | 5,5-Dimethyl-2-Phenyl-1-Pyrroline-N-Oxide |
|---|---|
| Synonyms | 2,2-Dimethyl-1-Oxido-5-Phenyl-1-Pyrrolin-1-Ium; 2H-Pyrrole, 3,4-Dihydro-2,2-Dimethyl-5-Phenyl-, 1-Oxide; 3,4-Dihydro-2,2-Dimethyl-5-Phenyl-2H-Pyrrole 1-Oxide |
| Molecular Structure | ![]() |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 |
| CAS Registry Number | 58134-17-1 |
| SMILES | C1=CC=CC=C1C2=[N+](C(C)(C)CC2)[O-] |
| InChI | 1S/C12H15NO/c1-12(2)9-8-11(13(12)14)10-6-4-3-5-7-10/h3-7H,8-9H2,1-2H3 |
| InChIKey | WNWSBJPGOXENQE-UHFFFAOYSA-N |
| Density | 1.06g/cm3 (Cal.) |
|---|---|
| Boiling point | 306.044°C at 760 mmHg (Cal.) |
| Flash point | 134.067°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,5-Dimethyl-2-Phenyl-1-Pyrroline-N-Oxide |