|
CAS#: 58139-33-6 Product: Methylnitrosocarbamic Acid 3,4-Xylyl Ester No suppilers available for the product. |
| Name | Methylnitrosocarbamic Acid 3,4-Xylyl Ester |
|---|---|
| Synonyms | (3,4-Dimethylphenyl) N-Methyl-N-Nitroso-Carbamate; N-Methyl-N-Nitrosocarbamic Acid (3,4-Dimethylphenyl) Ester; N-Methyl-N-Nitroso-Carbamic Acid (3,4-Dimethylphenyl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 |
| CAS Registry Number | 58139-33-6 |
| SMILES | C1=C(OC(=O)N(C)N=O)C=CC(=C1C)C |
| InChI | 1S/C10H12N2O3/c1-7-4-5-9(6-8(7)2)15-10(13)12(3)11-14/h4-6H,1-3H3 |
| InChIKey | HHNVRZPRZQZGFZ-UHFFFAOYSA-N |
| Density | 1.163g/cm3 (Cal.) |
|---|---|
| Boiling point | 293.29°C at 760 mmHg (Cal.) |
| Flash point | 131.177°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methylnitrosocarbamic Acid 3,4-Xylyl Ester |