|
CAS#: 5816-02-4 Product: 10,10'-(1,2-Ethanediylidene)Bisanthracen-9(10H)-One No suppilers available for the product. |
| Name | 10,10'-(1,2-Ethanediylidene)Bisanthracen-9(10H)-One |
|---|---|
| Synonyms | 10-[2-(10-Oxo-9-Anthrylidene)Ethylidene]Anthracen-9-One; 10-[2-(10-Oxo-9-Anthrylidene)Ethylidene]-9-Anthracenone; 10-[2-(10-Keto-9-Anthrylidene)Ethylidene]Anthracen-9-One |
| Molecular Structure | ![]() |
| Molecular Formula | C30H18O2 |
| Molecular Weight | 410.47 |
| CAS Registry Number | 5816-02-4 |
| EINECS | 227-387-0 |
| SMILES | C3=C2C(C1=CC=CC=C1C(=O)C2=CC=C3)=C\C=C5/C4=CC=CC=C4C(=O)C6=C5C=CC=C6 |
| InChI | 1S/C30H18O2/c31-29-25-13-5-1-9-19(25)23(20-10-2-6-14-26(20)29)17-18-24-21-11-3-7-15-27(21)30(32)28-16-8-4-12-22(24)28/h1-18H |
| InChIKey | JDBNNTPOYYRPHV-UHFFFAOYSA-N |
| Density | 1.377g/cm3 (Cal.) |
|---|---|
| Boiling point | 669.206°C at 760 mmHg (Cal.) |
| Flash point | 239.464°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 10,10'-(1,2-Ethanediylidene)Bisanthracen-9(10H)-One |