Online Database of Chemicals from Around the World
|
CAS#: 582-08-1 Product: 2,2'-Azonaphthalene No suppilers available for the product. |
| Name | 2,2'-Azonaphthalene |
|---|---|
| Synonyms | Brn 0959431; Di-Beta-Naphthyldiimide; Bis(2-Naphthyl)Diazene |
| Molecular Structure |  |
| Molecular Formula | C20H14N2 |
| Molecular Weight | 282.34 |
| CAS Registry Number | 582-08-1 |
| SMILES | C1=C4C(=CC=C1N=NC2=CC=C3C(=C2)C=CC=C3)C=CC=C4 |
| InChI | 1S/C20H14N2/c1-3-7-17-13-19(11-9-15(17)5-1)21-22-20-12-10-16-6-2-4-8-18(16)14-20/h1-14H |
| InChIKey | GSCOATNEHHMXKY-UHFFFAOYSA-N |
| Density | 1.13g/cm3 (Cal.) |
|---|---|
| Boiling point | 484.516°C at 760 mmHg (Cal.) |
| Flash point | 239.763°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2'-Azonaphthalene |