|
CAS#: 58286-46-7 Product: Phallisacin No suppilers available for the product. |
| Name | Phallisacin |
|---|---|
| Synonyms | Phallisacin |
| Molecular Structure | ![]() |
| Molecular Formula | C37H50N8O14S |
| Molecular Weight | 862.91 |
| CAS Registry Number | 58286-46-7 |
| SMILES | C5=C4C3=C(SCC1NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C2N(C1=O)CC(O)C2)C)C3)CC(O)(CO)CO)C(C)C)C(O)C(=O)O)[NH]C4=CC=C5 |
| InChI | 1S/C37H50N8O14S/c1-15(2)25-32(54)44-26(27(49)36(57)58)33(55)41-23-12-60-34-19(18-6-4-5-7-20(18)42-34)9-21(29(51)40-22(30(52)43-25)10-37(59,13-46)14-47)39-28(50)16(3)38-31(53)24-8-17(48)11-45(24)35(23)56/h4-7,15-17,21-27,42,46-49,59H,8-14H2,1-3H3,(H,38,53)(H,39,50)(H,40,51)(H,41,55)(H,43,52)(H,44,54)(H,57,58) |
| InChIKey | CUMAQJMTVOVGKD-UHFFFAOYSA-N |
| Density | 1.584g/cm3 (Cal.) |
|---|---|
| Boiling point | 1512.122°C at 760 mmHg (Cal.) |
| Flash point | 868.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phallisacin |