|
CAS#: 58324-16-6 Product: 3-Methoxy-4-(Morpholinomethyl)-9(10H)-Acridone No suppilers available for the product. |
| Name | 3-Methoxy-4-(Morpholinomethyl)-9(10H)-Acridone |
|---|---|
| Synonyms | 3-Methoxy-4-(Morpholinomethyl)-10H-Acridin-9-One; Brn 1162972; 3-Methoxy-4-(Morpholinomethyl)Acridone |
| Molecular Structure | ![]() |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 |
| CAS Registry Number | 58324-16-6 |
| SMILES | C1=CC(=C(C2=C1C(C3=C(N2)C=CC=C3)=O)CN4CCOCC4)OC |
| InChI | 1S/C19H20N2O3/c1-23-17-7-6-14-18(15(17)12-21-8-10-24-11-9-21)20-16-5-3-2-4-13(16)19(14)22/h2-7H,8-12H2,1H3,(H,20,22) |
| InChIKey | CHIBKZGEOGLDIB-UHFFFAOYSA-N |
| Density | 1.247g/cm3 (Cal.) |
|---|---|
| Boiling point | 500.812°C at 760 mmHg (Cal.) |
| Flash point | 256.682°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methoxy-4-(Morpholinomethyl)-9(10H)-Acridone |