|
CAS#: 58342-28-2 Product: Endo-4-Bicyclo[2.2.1]Hept-5-En-2-Yl-3-Buten-2-One No suppilers available for the product. |
| Name | Endo-4-Bicyclo[2.2.1]Hept-5-En-2-Yl-3-Buten-2-One |
|---|---|
| Synonyms | Endo-4-Bicyclo(2.2.1)Hept-5-En-2-Yl-3-Buten-2-One; Nsc620527 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 |
| CAS Registry Number | 58342-28-2 |
| EINECS | 261-219-7 |
| SMILES | CC(=O)\C=C/C1C2CC(C1)C=C2 |
| InChI | 1S/C11H14O/c1-8(12)2-4-10-6-9-3-5-11(10)7-9/h2-5,9-11H,6-7H2,1H3/b4-2- |
| InChIKey | PJNSTJMFXBGTIM-RQOWECAXSA-N |
| Density | 1.096g/cm3 (Cal.) |
|---|---|
| Boiling point | 260.634°C at 760 mmHg (Cal.) |
| Flash point | 108.18°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Endo-4-Bicyclo[2.2.1]Hept-5-En-2-Yl-3-Buten-2-One |