|
CAS#: 58330-11-3 Product: 1-(4-Methoxyphenyl)-6-Phenyl-1,3,4,6-Hexanetetrone No suppilers available for the product. |
| Name | 1-(4-Methoxyphenyl)-6-Phenyl-1,3,4,6-Hexanetetrone |
|---|---|
| Synonyms | 1-(4-Methoxyphenyl)-6-phenyl-1,3,4,6-hexanetetrone # |
| Molecular Structure | ![]() |
| Molecular Formula | C19H16O5 |
| Molecular Weight | 324.33 |
| CAS Registry Number | 58330-11-3 |
| SMILES | O=C(c1ccccc1)CC(=O)C(=O)CC(=O)c2ccc(OC)cc2 |
| InChI | 1S/C19H16O5/c1-24-15-9-7-14(8-10-15)17(21)12-19(23)18(22)11-16(20)13-5-3-2-4-6-13/h2-10H,11-12H2,1H3 |
| InChIKey | HUPUFFIISSXCQB-UHFFFAOYSA-N |
| Density | 1.226g/cm3 (Cal.) |
|---|---|
| Boiling point | 508.486°C at 760 mmHg (Cal.) |
| Flash point | 224.927°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4-Methoxyphenyl)-6-Phenyl-1,3,4,6-Hexanetetrone |