|
CAS#: 58344-47-1 Product: 1-(3,4,5-Trimethoxyphenyl)-4,4-Dimethyl-1-Penten-3-Ol No suppilers available for the product. |
| Name | 1-(3,4,5-Trimethoxyphenyl)-4,4-Dimethyl-1-Penten-3-Ol |
|---|---|
| Synonyms | 1-Penten-3-Ol, 4,4-Dimethyl-1-(3,4,5-Trimethoxyphenyl)-; 4,4-Dimethyl-1-(3,4,5-Trimethoxyphenyl)-1-Penten-3-Ol; Brn 2278853 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 |
| CAS Registry Number | 58344-47-1 |
| SMILES | C1=C(C(=C(C=C1\C=C\C(C(C)(C)C)O)OC)OC)OC |
| InChI | 1S/C16H24O4/c1-16(2,3)14(17)8-7-11-9-12(18-4)15(20-6)13(10-11)19-5/h7-10,14,17H,1-6H3/b8-7+ |
| InChIKey | LVYHQBFMMMDUTF-BQYQJAHWSA-N |
| Density | 1.053g/cm3 (Cal.) |
|---|---|
| Boiling point | 411.406°C at 760 mmHg (Cal.) |
| Flash point | 202.611°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(3,4,5-Trimethoxyphenyl)-4,4-Dimethyl-1-Penten-3-Ol |