|
CAS#: 58371-68-9 Product: 5-(1,1-Dimethylethyl)-3b,4,6,7,9,9a,10,15-octahydro-5H-Benzo[5,6]cyclohepta[1,2,3-de]pyrido[2,1-a]isoquinolin-5-ol No suppilers available for the product. |
| Name | 5-(1,1-Dimethylethyl)-3b,4,6,7,9,9a,10,15-octahydro-5H-Benzo[5,6]cyclohepta[1,2,3-de]pyrido[2,1-a]isoquinolin-5-ol |
|---|---|
| Synonyms | Ay 23396; Isobutaclamol |
| Molecular Structure | ![]() |
| Molecular Formula | C25H31NO |
| Molecular Weight | 361.53 |
| CAS Registry Number | 58371-68-9 |
| SMILES | C1=CC=C4C2=C1C5N(CC2CC3=CC=CC=C3C4)CCC(O)(C5)C(C)(C)C |
| InChI | 1S/C25H31NO/c1-24(2,3)25(27)11-12-26-16-20-14-18-8-5-4-7-17(18)13-19-9-6-10-21(23(19)20)22(26)15-25/h4-10,20,22,27H,11-16H2,1-3H3 |
| InChIKey | DAVHTUSZZYGLKT-UHFFFAOYSA-N |
| Density | 1.165g/cm3 (Cal.) |
|---|---|
| Boiling point | 499.116°C at 760 mmHg (Cal.) |
| Flash point | 238.854°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(1,1-Dimethylethyl)-3b,4,6,7,9,9a,10,15-octahydro-5H-Benzo[5,6]cyclohepta[1,2,3-de]pyrido[2,1-a]isoquinolin-5-ol |