|
CAS#: 584-28-1 Product: Aspidin BB No suppilers available for the product. |
| Name | Aspidin BB |
|---|---|
| Synonyms | 2-Butanoyl-4-[(3-Butanoyl-2,6-Dihydroxy-4-Methoxy-5-Methyl-Phenyl)Methyl]-3,5-Dihydroxy-6,6-Dimethyl-Cyclohexa-2,4-Dien-1-One; 4-[[2,6-Dihydroxy-4-Methoxy-3-Methyl-5-(1-Oxobutyl)Phenyl]Methyl]-3,5-Dihydroxy-6,6-Dimethyl-2-(1-Oxobutyl)-1-Cyclohexa-2,4-Dienone; 2-Butyryl-4-(3-Butyryl-2,6-Dihydroxy-4-Methoxy-5-Methyl-Benzyl)-3,5-Dihydroxy-6,6-Dimethyl-Cyclohexa-2,4-Dien-1-One |
| Molecular Structure | ![]() |
| Molecular Formula | C25H32O8 |
| Molecular Weight | 460.52 |
| CAS Registry Number | 584-28-1 |
| SMILES | C(C1=C(O)C(C(=O)C(=C1O)C(=O)CCC)(C)C)C2=C(O)C(=C(OC)C(=C2O)C)C(=O)CCC |
| InChI | 1S/C25H32O8/c1-7-9-15(26)17-20(29)13(19(28)12(3)22(17)33-6)11-14-21(30)18(16(27)10-8-2)24(32)25(4,5)23(14)31/h28-31H,7-11H2,1-6H3 |
| InChIKey | PLGZOIJJUOHZJA-UHFFFAOYSA-N |
| Density | 1.286g/cm3 (Cal.) |
|---|---|
| Boiling point | 704.893°C at 760 mmHg (Cal.) |
| Flash point | 236.571°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Aspidin BB |