|
CAS#: 58451-85-7 Product: alpha,alpha,alpha',alpha'-Tetraphenyl-2,6-Piperidinedimethanol No suppilers available for the product. |
| Name | alpha,alpha,alpha',alpha'-Tetraphenyl-2,6-Piperidinedimethanol |
|---|---|
| Synonyms | [6-[Hydroxy-Di(Phenyl)Methyl]-2-Piperidyl]-Di(Phenyl)Methanol; [6-[Hydroxy-Di(Phenyl)Methyl]-2-Piperidinyl]-Di(Phenyl)Methanol; 2,6-Bis(Diphenylhydroxymethyl)-Piperidine |
| Molecular Structure | ![]() |
| Molecular Formula | C31H31NO2 |
| Molecular Weight | 449.59 |
| CAS Registry Number | 58451-85-7 |
| SMILES | C5=C(C(C1=CC=CC=C1)(C2NC(CCC2)C(C3=CC=CC=C3)(C4=CC=CC=C4)O)O)C=CC=C5 |
| InChI | 1S/C31H31NO2/c33-30(24-14-5-1-6-15-24,25-16-7-2-8-17-25)28-22-13-23-29(32-28)31(34,26-18-9-3-10-19-26)27-20-11-4-12-21-27/h1-12,14-21,28-29,32-34H,13,22-23H2 |
| InChIKey | JFGXCMKVTZAJMD-UHFFFAOYSA-N |
| Density | 1.177g/cm3 (Cal.) |
|---|---|
| Boiling point | 639.697°C at 760 mmHg (Cal.) |
| Flash point | 107.474°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for alpha,alpha,alpha',alpha'-Tetraphenyl-2,6-Piperidinedimethanol |