|
CAS#: 58470-73-8 Product: 5-[6-Benzoylbenz[cd]Indol-2(1H)-Ylidene]-1,3-Dimethyl-1H,3H,5H-Pyrimidine-2,4,6-Trione No suppilers available for the product. |
| Name | 5-[6-Benzoylbenz[cd]Indol-2(1H)-Ylidene]-1,3-Dimethyl-1H,3H,5H-Pyrimidine-2,4,6-Trione |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C24H17N3O4 |
| Molecular Weight | 411.42 |
| CAS Registry Number | 58470-73-8 |
| EINECS | 261-268-4 |
| SMILES | C1=CC=C3C2=C1C(NC2=CC=C3C(=O)C4=CC=CC=C4)=C5C(=O)N(C(=O)N(C5=O)C)C |
| InChI | 1S/C24H17N3O4/c1-26-22(29)19(23(30)27(2)24(26)31)20-16-10-6-9-14-15(11-12-17(25-20)18(14)16)21(28)13-7-4-3-5-8-13/h3-12,25H,1-2H3 |
| InChIKey | MOCWOVLARTYTRK-UHFFFAOYSA-N |
| Density | 1.418g/cm3 (Cal.) |
|---|---|
| Boiling point | 589.401°C at 760 mmHg (Cal.) |
| Flash point | 310.259°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-[6-Benzoylbenz[cd]Indol-2(1H)-Ylidene]-1,3-Dimethyl-1H,3H,5H-Pyrimidine-2,4,6-Trione |