Online Database of Chemicals from Around the World
|
CAS#: 58487-16-4 Product: Naphthalene-1,5-Dimaleimide No suppilers available for the product. |
| Name | Naphthalene-1,5-Dimaleimide |
|---|---|
| Synonyms | 1-[5-(2,5-Dioxopyrrol-1-Yl)-1-Naphthyl]Pyrrole-2,5-Dione; 1-[5-(2,5-Dioxo-1-Pyrrolyl)-1-Naphthyl]Pyrrole-2,5-Dione; 1-(5-Maleimido-1-Naphthyl)-3-Pyrroline-2,5-Quinone |
| Molecular Structure |  |
| Molecular Formula | C18H10N2O4 |
| Molecular Weight | 318.29 |
| CAS Registry Number | 58487-16-4 |
| SMILES | C2=C(C1=CC=CC(=C1C=C2)N3C(C=CC3=O)=O)N4C(C=CC4=O)=O |
| InChI | 1S/C18H10N2O4/c21-15-7-8-16(22)19(15)13-5-1-3-11-12(13)4-2-6-14(11)20-17(23)9-10-18(20)24/h1-10H |
| InChIKey | RQKQQZAZSOOCFT-UHFFFAOYSA-N |
| Density | 1.551g/cm3 (Cal.) |
|---|---|
| Boiling point | 556.644°C at 760 mmHg (Cal.) |
| Flash point | 274.584°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Naphthalene-1,5-Dimaleimide |