| 
CAS#: 58639-24-0 Product: 2-Dimethylamino-4-(N-Methylanilino)Phenol No suppilers available for the product.  | 
| Name | 2-Dimethylamino-4-(N-Methylanilino)Phenol | 
|---|---|
| Synonyms | 2-Dimethylamino-4-(Methyl-Phenyl-Amino)Phenol; 2-Dimethylamino-4-(N-Methylanilino)Phenol; 2-Dimethylamino-4-(Methylphenylamino)Phenol | 
| Molecular Structure | ![]()  | 
| Molecular Formula | C15H18N2O | 
| Molecular Weight | 242.32 | 
| CAS Registry Number | 58639-24-0 | 
| SMILES | C1=C(C(=CC=C1N(C2=CC=CC=C2)C)O)N(C)C | 
| InChI | 1S/C15H18N2O/c1-16(2)14-11-13(9-10-15(14)18)17(3)12-7-5-4-6-8-12/h4-11,18H,1-3H3 | 
| InChIKey | BHZGTBGNEIZHIQ-UHFFFAOYSA-N | 
| Density | 1.152g/cm3 (Cal.) | 
|---|---|
| Boiling point | 397.273°C at 760 mmHg (Cal.) | 
| Flash point | 201.015°C (Cal.) | 
| Market Analysis Reports | 
| List of Reports Available for 2-Dimethylamino-4-(N-Methylanilino)Phenol |