|
CAS#: 58786-39-3 Product: 1,6-Diazafluoranthene No suppilers available for the product. |
| Name | 1,6-Diazafluoranthene |
|---|---|
| Synonyms | Aids-008760; Eupolauridine; Indeno(1,2,3-Ij)(2,7)Naphthyridine |
| Molecular Structure | ![]() |
| Molecular Formula | C14H8N2 |
| Molecular Weight | 204.23 |
| CAS Registry Number | 58786-39-3 |
| SMILES | C4=CC1=C3C(=NC=C1)C2=CC=CC=C2C3=N4 |
| InChI | 1S/C14H8N2/c1-2-4-11-10(3-1)13-12-9(5-7-15-13)6-8-16-14(11)12/h1-8H |
| InChIKey | KIVUUVOREYMMFE-UHFFFAOYSA-N |
| Density | 1.376g/cm3 (Cal.) |
|---|---|
| Boiling point | 399.914°C at 760 mmHg (Cal.) |
| Flash point | 181.621°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,6-Diazafluoranthene |