|
CAS#: 58844-75-0 Product: 2-[(2,3-Dimethylphenyl)Sulfonyl]Benzoic Acid No suppilers available for the product. |
| Name | 2-[(2,3-Dimethylphenyl)Sulfonyl]Benzoic Acid |
|---|---|
| Synonyms | O-((2,3-Xylyl)Sulfonyl)Benzoic Acid; 2-((2,3-Dimethylphenyl)Sulfonyl)Benzoic Acid; Benzoic Acid, O-((2,3-Xylyl)Sulfonyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14O4S |
| Molecular Weight | 290.33 |
| CAS Registry Number | 58844-75-0 |
| SMILES | C2=C([S](C1=CC=CC(=C1C)C)(=O)=O)C(=CC=C2)C(O)=O |
| InChI | 1S/C15H14O4S/c1-10-6-5-9-13(11(10)2)20(18,19)14-8-4-3-7-12(14)15(16)17/h3-9H,1-2H3,(H,16,17) |
| InChIKey | ADTDTEOEJQZOKN-UHFFFAOYSA-N |
| Density | 1.303g/cm3 (Cal.) |
|---|---|
| Boiling point | 520.601°C at 760 mmHg (Cal.) |
| Flash point | 268.65°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(2,3-Dimethylphenyl)Sulfonyl]Benzoic Acid |