Online Database of Chemicals from Around the World
|
CAS#: 58883-50-4 Product: Allyl Pentafluoropropionate No suppilers available for the product. |
| Name | Allyl Pentafluoropropionate |
|---|---|
| Synonyms | Allyl 2,2,3,3,3-Pentafluoropropanoate; 2,2,3,3,3-Pentafluoropropanoic Acid Allyl Ester; 2,2,3,3,3-Pentafluoropropionic Acid Allyl Ester |
| Molecular Structure |  |
| Molecular Formula | C6H5F5O2 |
| Molecular Weight | 204.10 |
| CAS Registry Number | 58883-50-4 |
| EINECS | 261-483-3 |
| SMILES | C(C=C)OC(C(C(F)(F)F)(F)F)=O |
| InChI | 1S/C6H5F5O2/c1-2-3-13-4(12)5(7,8)6(9,10)11/h2H,1,3H2 |
| InChIKey | AMEPFZHWBYLCRO-UHFFFAOYSA-N |
| Density | 1.33g/cm3 (Cal.) |
|---|---|
| Boiling point | 126.908°C at 760 mmHg (Cal.) |
| Flash point | 36.679°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Allyl Pentafluoropropionate |